CAS 743452-12-2 is the registry number for 2-Chloro-N-(2-(2,4-dichlorophenyl)-2-(1H-indol-3-yl)ethyl)acetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-N-[2-(2,4-dichlorophenyl)-2-(1H-indol-3-yl)ethyl]acetamide (CAS 743452-12-2) is a chemical compound with the molecular formula C18H15Cl3N2O and a molecular weight of 381.7 g/mol. IUPAC name: 2-chloro-N-[2-(2,4-dichlorophenyl)-2-(1H-indol-3-yl)ethyl]acetamide. InChIKey: ITGIDOWHENJHKI-UHFFFAOYSA-N.
| Molecular formula | C18H15Cl3N2O |
|---|---|
| Molecular weight | 381.7 g/mol |
| IUPAC name | 2-chloro-N-[2-(2,4-dichlorophenyl)-2-(1H-indol-3-yl)ethyl]acetamide |
| InChIKey | ITGIDOWHENJHKI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(CNC(=O)CCl)C3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)