Products 74356-49-3
CAS 74356-49-3 is the registry number for 1-Octen-3-ol glucoside. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg, 1000mg.
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-oct-1-en-3-yloxyoxane-3,4,5-triol (CAS 74356-49-3) is a chemical compound with the molecular formula C14H26O6 and a molecular weight of 290.35 g/mol. IUPAC name: (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-oct-1-en-3-yloxyoxane-3,4,5-triol. InChIKey: MPSRBJBPHXIOFN-MXNNCRBYSA-N.
| Molecular formula | C14H26O6 |
|---|---|
| Molecular weight | 290.35 g/mol |
| IUPAC name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-oct-1-en-3-yloxyoxane-3,4,5-triol |
| InChIKey | MPSRBJBPHXIOFN-MXNNCRBYSA-N |
| SMILES | CCCCCC(C=C)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)