Products 74367-32-1

CAS 74367-32-1 is the registry number for 2-(Hydroxymethyl)-1-propylbutyl 2-Methylpropanoate. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(hydroxymethyl)heptan-4-yl 2-methylpropanoate (CAS 74367-32-1) is a chemical compound with the molecular formula C12H24O3 and a molecular weight of 216.32 g/mol. IUPAC name: 3-(hydroxymethyl)heptan-4-yl 2-methylpropanoate. InChIKey: SXNNFRPGPOKUEN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H24O3
Molecular weight216.32 g/mol
IUPAC name3-(hydroxymethyl)heptan-4-yl 2-methylpropanoate
InChIKeySXNNFRPGPOKUEN-UHFFFAOYSA-N
SMILESCCCC(C(CC)CO)OC(=O)C(C)C

Computed by PubChem (NCBI)