CAS 74367-87-6 is the registry number for 4-(4-Ethoxyphenylazo)-m-phenylenediamine, mixture of mono and dihydrochloride, 98%. Offered by: Thermo Scientific (Acros). Available pack sizes: 10g.
4-[(4-ethoxyphenyl)diazenyl]benzene-1,3-diamine;hydrochloride (CAS 74367-87-6) is a chemical compound with the molecular formula C14H17ClN4O and a molecular weight of 292.76 g/mol. IUPAC name: 4-[(4-ethoxyphenyl)diazenyl]benzene-1,3-diamine;hydrochloride. InChIKey: IWHXNINOLLNFGP-UHFFFAOYSA-N.
| Molecular formula | C14H17ClN4O |
|---|---|
| Molecular weight | 292.76 g/mol |
| IUPAC name | 4-[(4-ethoxyphenyl)diazenyl]benzene-1,3-diamine;hydrochloride |
| InChIKey | IWHXNINOLLNFGP-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)N=NC2=C(C=C(C=C2)N)N.Cl |
Computed by PubChem (NCBI)