CAS 74422-48-3 appears in our catalog under these names: Desmethylclotiazepam Uncyclized Intermediate (hydrochloride), Desmethylclotiazepam Uncyclized Intermediate (hydrochloride). Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg, 5 mg.
2-amino-N-[3-(2-chlorobenzoyl)-5-ethylthiophen-2-yl]acetamide;hydrochloride (CAS 74422-48-3) is a chemical compound with the molecular formula C15H16Cl2N2O2S and a molecular weight of 359.3 g/mol. IUPAC name: 2-amino-N-[3-(2-chlorobenzoyl)-5-ethylthiophen-2-yl]acetamide;hydrochloride. InChIKey: GGMAWMYDDRIJQQ-UHFFFAOYSA-N.
| Molecular formula | C15H16Cl2N2O2S |
|---|---|
| Molecular weight | 359.3 g/mol |
| IUPAC name | 2-amino-N-[3-(2-chlorobenzoyl)-5-ethylthiophen-2-yl]acetamide;hydrochloride |
| InChIKey | GGMAWMYDDRIJQQ-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(S1)NC(=O)CN)C(=O)C2=CC=CC=C2Cl.Cl |
Computed by PubChem (NCBI)