CAS 744226-69-5 is the registry number for N-(tert-Butyl)-7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-tert-butyl-7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide (CAS 744226-69-5) is a chemical compound with the molecular formula C11H15N5O and a molecular weight of 233.27 g/mol. IUPAC name: N-tert-butyl-7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide. InChIKey: NZOGLRPSPAOVJE-UHFFFAOYSA-N.
| Molecular formula | C11H15N5O |
|---|---|
| Molecular weight | 233.27 g/mol |
| IUPAC name | N-tert-butyl-7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| InChIKey | NZOGLRPSPAOVJE-UHFFFAOYSA-N |
| SMILES | CC1=CC=NC2=NC(=NN12)C(=O)NC(C)(C)C |
Computed by PubChem (NCBI)