Products 744243-49-0
CAS 744243-49-0 appears in our catalog under these names: 2-Chloro-n-(2-oxo-2-[(2,3,4-trifluorophenyl)amino]ethyl)acetamide, 95%, 2-Chloro-N-{((2,3,4-trifluorophenyl)carbamoyl)methyl}acetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[(2-chloroacetyl)amino]-N-(2,3,4-trifluorophenyl)acetamide (CAS 744243-49-0) is a chemical compound with the molecular formula C10H8ClF3N2O2 and a molecular weight of 280.63 g/mol. IUPAC name: 2-[(2-chloroacetyl)amino]-N-(2,3,4-trifluorophenyl)acetamide. InChIKey: CFYTVQHDJRAHSH-UHFFFAOYSA-N.
| Molecular formula | C10H8ClF3N2O2 |
|---|---|
| Molecular weight | 280.63 g/mol |
| IUPAC name | 2-[(2-chloroacetyl)amino]-N-(2,3,4-trifluorophenyl)acetamide |
| InChIKey | CFYTVQHDJRAHSH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1NC(=O)CNC(=O)CCl)F)F)F |
Computed by PubChem (NCBI)