CAS 7445-36-5 appears in our catalog under these names: Simethicone Impurity 5 (1,1,3,3,5,5,7,7,9,9-decamethyl-1,9-Pentasiloxanediol), Simethicone Impurity 14, Decamethyl-1,9-Pentasiloxanediol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg, 50mg.
Bis[[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxy]-dimethylsilane (CAS 7445-36-5) is a chemical compound with the molecular formula C10H32O6Si5 and a molecular weight of 388.78 g/mol. IUPAC name: bis[[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxy]-dimethylsilane. InChIKey: MHQYXFZBMMHEST-UHFFFAOYSA-N.
| Molecular formula | C10H32O6Si5 |
|---|---|
| Molecular weight | 388.78 g/mol |
| IUPAC name | bis[[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxy]-dimethylsilane |
| InChIKey | MHQYXFZBMMHEST-UHFFFAOYSA-N |
| SMILES | C[Si](C)(O)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O |
Computed by PubChem (NCBI)