CAS 74458-65-4 appears in our catalog under these names: ((1R,3S)-1,2,2,3-Tetramethylcyclopentyl)methanol, 95%, ((1R,3S)-1,2,2,3-Tetramethylcyclopentyl)methanol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
[(1R,3S)-1,2,2,3-tetramethylcyclopentyl]methanol (CAS 74458-65-4) is a chemical compound with the molecular formula C10H20O and a molecular weight of 156.26 g/mol. IUPAC name: [(1R,3S)-1,2,2,3-tetramethylcyclopentyl]methanol. InChIKey: VEWDCYUJDMVTFQ-WPRPVWTQSA-N.
| Molecular formula | C10H20O |
|---|---|
| Molecular weight | 156.26 g/mol |
| IUPAC name | [(1R,3S)-1,2,2,3-tetramethylcyclopentyl]methanol |
| InChIKey | VEWDCYUJDMVTFQ-WPRPVWTQSA-N |
| SMILES | C[C@H]1CC[C@@](C1(C)C)(C)CO |
Computed by PubChem (NCBI)