CAS 74472-41-6 appears in our catalog under these names: 2,2',3,4',5,6'-Hexachlorobiphenyl, PCB 148, ROTI®Star, 5 mg, glass. Offered by: Biosynth, Roth. Available pack sizes: 25ml, 50ml, 5mg.
1,2,5-trichloro-3-(2,4,6-trichlorophenyl)benzene (CAS 74472-41-6) is a chemical compound with the molecular formula C12H4Cl6 and a molecular weight of 360.9 g/mol. IUPAC name: 1,2,5-trichloro-3-(2,4,6-trichlorophenyl)benzene. InChIKey: CTVRBEKNQHJPLX-UHFFFAOYSA-N.
| Molecular formula | C12H4Cl6 |
|---|---|
| Molecular weight | 360.9 g/mol |
| IUPAC name | 1,2,5-trichloro-3-(2,4,6-trichlorophenyl)benzene |
| InChIKey | CTVRBEKNQHJPLX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C2=C(C=C(C=C2Cl)Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)