CAS 74479-46-2 appears in our catalog under these names: Acitretin Impurity 10, Acitretin Impurity 3, (2E,4E,6E,8E)-9-(4-Methoxy-2,3,6-trimethylphenyl)-3,7-dimethyl-2,4,6,8-Nonatetraenoic Acid 1-Methylethyl Ester. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 5mg.
Propan-2-yl (2E,4E,6E,8E)-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate (CAS 74479-46-2) is a chemical compound with the molecular formula C24H32O3 and a molecular weight of 368.5 g/mol. IUPAC name: propan-2-yl (2E,4E,6E,8E)-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate. InChIKey: COXHAKBLKRAXPL-KNSIPEQSSA-N.
| Molecular formula | C24H32O3 |
|---|---|
| Molecular weight | 368.5 g/mol |
| IUPAC name | propan-2-yl (2E,4E,6E,8E)-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate |
| InChIKey | COXHAKBLKRAXPL-KNSIPEQSSA-N |
| SMILES | CC1=CC(=C(C(=C1/C=C/C(=C/C=C/C(=C/C(=O)OC(C)C)/C)/C)C)C)OC |
Computed by PubChem (NCBI)