CAS 74489-49-9 appears in our catalog under these names: 1-Azido-4-(bromomethyl)benzene, 1-Azido-4-(bromomethyl)benzene 95%. Offered by: TRC, Ambeed. Available pack sizes: 10mg, 1mg, 5mg, 50mg, 100mg, 250mg, 1g.
1-azido-4-(bromomethyl)benzene (CAS 74489-49-9) is a chemical compound with the molecular formula C7H6BrN3 and a molecular weight of 212.05 g/mol. IUPAC name: 1-azido-4-(bromomethyl)benzene. InChIKey: ZEGXJLLXAKNJOU-UHFFFAOYSA-N.
| Molecular formula | C7H6BrN3 |
|---|---|
| Molecular weight | 212.05 g/mol |
| IUPAC name | 1-azido-4-(bromomethyl)benzene |
| InChIKey | ZEGXJLLXAKNJOU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CBr)N=[N+]=[N-] |
Computed by PubChem (NCBI)