CAS 74492-28-7 is the registry number for 2-Bromo-2,2-difluoro-1-phenylethanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-bromo-2,2-difluoro-1-phenylethanol (CAS 74492-28-7) is a chemical compound with the molecular formula C8H7BrF2O and a molecular weight of 237.04 g/mol. IUPAC name: 2-bromo-2,2-difluoro-1-phenylethanol. InChIKey: NIHSGGJHKRBRNH-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF2O |
|---|---|
| Molecular weight | 237.04 g/mol |
| IUPAC name | 2-bromo-2,2-difluoro-1-phenylethanol |
| InChIKey | NIHSGGJHKRBRNH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(F)(F)Br)O |
Computed by PubChem (NCBI)