CAS 7453-26-1 appears in our catalog under these names: 1,3–Dimethyl–1,1,3,3–tetraphenyldisilazane, 1,3-Dimethyl-1,1,3,3-tetraphenyldisilazane, >95.0%(GC), Bis(Methyldiphenylsilyl)Amine, 97%, 97%, 1,1,3,3-Tetraphenyl-1,3-dimethyldisilazane. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
[methyl-[[methyl(diphenyl)silyl]amino]-phenylsilyl]benzene (CAS 7453-26-1) is a chemical compound with the molecular formula C26H27NSi2 and a molecular weight of 409.7 g/mol. IUPAC name: [methyl-[[methyl(diphenyl)silyl]amino]-phenylsilyl]benzene. InChIKey: YFONAHAKNVIHPT-UHFFFAOYSA-N.
| Molecular formula | C26H27NSi2 |
|---|---|
| Molecular weight | 409.7 g/mol |
| IUPAC name | [methyl-[[methyl(diphenyl)silyl]amino]-phenylsilyl]benzene |
| InChIKey | YFONAHAKNVIHPT-UHFFFAOYSA-N |
| SMILES | C[Si](C1=CC=CC=C1)(C2=CC=CC=C2)N[Si](C)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)