CAS 74535-75-4 is the registry number for Boc-Ala-Gly-OSu. Offered by: Creative Peptides, Biosynth. Available pack sizes: 5g, 25g, 10g, 50g.
(2,5-dioxopyrrolidin-1-yl) 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetate (CAS 74535-75-4) is a chemical compound with the molecular formula C14H21N3O7 and a molecular weight of 343.33 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetate. InChIKey: WONRGZBZQQESHS-QMMMGPOBSA-N.
| Molecular formula | C14H21N3O7 |
|---|---|
| Molecular weight | 343.33 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetate |
| InChIKey | WONRGZBZQQESHS-QMMMGPOBSA-N |
| SMILES | C[C@@H](C(=O)NCC(=O)ON1C(=O)CCC1=O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)