CAS 74550-92-8 appears in our catalog under these names: Ornidazole Impurity 8, Ornidazole Impurity 14. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-bis(2-methyl-5-nitroimidazol-1-yl)propan-2-ol (CAS 74550-92-8) is a chemical compound with the molecular formula C11H14N6O5 and a molecular weight of 310.27 g/mol. IUPAC name: 1,3-bis(2-methyl-5-nitroimidazol-1-yl)propan-2-ol. InChIKey: KAOLQMBIYJYWNM-UHFFFAOYSA-N.
| Molecular formula | C11H14N6O5 |
|---|---|
| Molecular weight | 310.27 g/mol |
| IUPAC name | 1,3-bis(2-methyl-5-nitroimidazol-1-yl)propan-2-ol |
| InChIKey | KAOLQMBIYJYWNM-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(N1CC(CN2C(=NC=C2[N+](=O)[O-])C)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)