Products 74556-58-4

CAS 74556-58-4 is the registry number for 5-(4-Bromophenoxymethyl)furan-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

5-[(4-bromophenoxy)methyl]furan-2-carboxylic acid (CAS 74556-58-4) is a chemical compound with the molecular formula C12H9BrO4 and a molecular weight of 297.10 g/mol. IUPAC name: 5-[(4-bromophenoxy)methyl]furan-2-carboxylic acid. InChIKey: OPOBLZKJGHHTAA-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9BrO4
Molecular weight297.10 g/mol
IUPAC name5-[(4-bromophenoxy)methyl]furan-2-carboxylic acid
InChIKeyOPOBLZKJGHHTAA-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1OCC2=CC=C(O2)C(=O)O)Br

Computed by PubChem (NCBI)