CAS 74572-19-3 is the registry number for Octahydro-2h-1,4-benzoxazine hydrobromide, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine (CAS 74572-19-3) is a chemical compound with the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. IUPAC name: (4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine. InChIKey: AGYZKRGPZJEWPN-HTQZYQBOSA-N.
| Molecular formula | C8H15NO |
|---|---|
| Molecular weight | 141.21 g/mol |
| IUPAC name | (4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine |
| InChIKey | AGYZKRGPZJEWPN-HTQZYQBOSA-N |
| SMILES | C1CC[C@@H]2[C@@H](C1)NCCO2 |
Computed by PubChem (NCBI)