Products 745783-74-8
CAS 745783-74-8 appears in our catalog under these names: (S)-(-)-1-(4-Fluorophenyl)ethyl isocyanate, 95%, (S)-(-)-1-(4-Fluorophenyl)ethyl isocyanate, 95% . Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g.
1-fluoro-4-[(1S)-1-isocyanatoethyl]benzene (CAS 745783-74-8) is a chemical compound with the molecular formula C9H8FNO and a molecular weight of 165.16 g/mol. IUPAC name: 1-fluoro-4-[(1S)-1-isocyanatoethyl]benzene. InChIKey: MUHCZVYPBWOTTJ-ZETCQYMHSA-N.
| Molecular formula | C9H8FNO |
|---|---|
| Molecular weight | 165.16 g/mol |
| IUPAC name | 1-fluoro-4-[(1S)-1-isocyanatoethyl]benzene |
| InChIKey | MUHCZVYPBWOTTJ-ZETCQYMHSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)F)N=C=O |
Computed by PubChem (NCBI)