Products 745783-98-6
CAS 745783-98-6 appears in our catalog under these names: (1R,2R)-(-)-2-Benzyloxycyclohexyl isothiocyanate, 95%, (1R,2R)–(–)–2–Benzyloxycyclohexyl isothiocyanate, (1R,2R)-(-)-2-Benzyloxycyclohexyl isothiocyanate, ≥97%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 250mg.
[(1R,2R)-2-isothiocyanatocyclohexyl]oxymethylbenzene (CAS 745783-98-6) is a chemical compound with the molecular formula C14H17NOS and a molecular weight of 247.36 g/mol. IUPAC name: [(1R,2R)-2-isothiocyanatocyclohexyl]oxymethylbenzene. InChIKey: DNRPSBSMXLYTQF-ZIAGYGMSSA-N.
| Molecular formula | C14H17NOS |
|---|---|
| Molecular weight | 247.36 g/mol |
| IUPAC name | [(1R,2R)-2-isothiocyanatocyclohexyl]oxymethylbenzene |
| InChIKey | DNRPSBSMXLYTQF-ZIAGYGMSSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)N=C=S)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)