Products 745784-05-8

CAS 745784-05-8 is the registry number for 2-Bromoquinoline-3-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

(2-bromoquinolin-3-yl)boronic acid (CAS 745784-05-8) is a chemical compound with the molecular formula C9H7BBrNO2 and a molecular weight of 251.87 g/mol. IUPAC name: (2-bromoquinolin-3-yl)boronic acid. InChIKey: RUDILYIFXMOEIO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7BBrNO2
Molecular weight251.87 g/mol
IUPAC name(2-bromoquinolin-3-yl)boronic acid
InChIKeyRUDILYIFXMOEIO-UHFFFAOYSA-N
SMILESB(C1=CC2=CC=CC=C2N=C1Br)(O)O

Computed by PubChem (NCBI)