CAS 74590-46-8 is the registry number for (2R,3R,4S,5S,6R)-2-(Acetoxymethyl)-6-(benzylthio)tetrahydro-2H-pyran-3,4,5-triyl triacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-benzylsulfanyloxan-2-yl]methyl acetate (CAS 74590-46-8) is a chemical compound with the molecular formula C21H26O9S and a molecular weight of 454.5 g/mol. IUPAC name: [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-benzylsulfanyloxan-2-yl]methyl acetate. InChIKey: UVVCYZREUQWNFB-CRSSMBPESA-N.
| Molecular formula | C21H26O9S |
|---|---|
| Molecular weight | 454.5 g/mol |
| IUPAC name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-benzylsulfanyloxan-2-yl]methyl acetate |
| InChIKey | UVVCYZREUQWNFB-CRSSMBPESA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)SCC2=CC=CC=C2)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)