CAS 902456-03-5 is the registry number for 1-Benzoyl-4-(2,3-dichlorophenyl)piperazine. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
[(3S,6S)-3,4,5-triacetyloxy-6-(4-methylphenyl)sulfanyloxan-2-yl]methyl acetate (CAS 902456-03-5) is a chemical compound with the molecular formula C21H26O9S and a molecular weight of 454.5 g/mol. IUPAC name: [(3S,6S)-3,4,5-triacetyloxy-6-(4-methylphenyl)sulfanyloxan-2-yl]methyl acetate. InChIKey: XRFOIRMXQHXTRL-BVSWNFQFSA-N.
| Molecular formula | C21H26O9S |
|---|---|
| Molecular weight | 454.5 g/mol |
| IUPAC name | [(3S,6S)-3,4,5-triacetyloxy-6-(4-methylphenyl)sulfanyloxan-2-yl]methyl acetate |
| InChIKey | XRFOIRMXQHXTRL-BVSWNFQFSA-N |
| SMILES | CC1=CC=C(C=C1)S[C@H]2C(C([C@H](C(O2)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)