CAS 7460-82-4 appears in our catalog under these names: 2-{2-[(4-Methylbenzenesulfonyl)oxy]ethoxy}ethyl 4-methylbenzene-1-sulfonate, 98%, Diethylene glycol bis(p-toluenesulfonate)/ 98.82% (existing batch purity), Diethylene glycol bis(p–toluenesulfonate), Diethylene Glycol Bis(p-toluenesulfonate), >96.0%(HPLC)(T), Diethylene glycol bis(p-toluenesulfonate) 97%. Offered by: Fluorochem, TargetMol, GLPBio, TCI, Ambeed. Available pack sizes: 10g, 25g, 100g, 500g, 1kg, 500mg, 5g, 1g.
2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethyl 4-methylbenzenesulfonate (CAS 7460-82-4) is a chemical compound with the molecular formula C18H22O7S2 and a molecular weight of 414.5 g/mol. IUPAC name: 2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: VYVPNTJBGPQTFA-UHFFFAOYSA-N.
| Molecular formula | C18H22O7S2 |
|---|---|
| Molecular weight | 414.5 g/mol |
| IUPAC name | 2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | VYVPNTJBGPQTFA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOS(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)