CAS 7461-11-2 appears in our catalog under these names: 2-Chloroquinolin-8-amine, 95%, 2-Chloroquinolin-8-amine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 10g, 5g.
2-chloroquinolin-8-amine (CAS 7461-11-2) is a chemical compound with the molecular formula C9H7ClN2 and a molecular weight of 178.62 g/mol. IUPAC name: 2-chloroquinolin-8-amine. InChIKey: IFHMCZLKPVRCEK-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2 |
|---|---|
| Molecular weight | 178.62 g/mol |
| IUPAC name | 2-chloroquinolin-8-amine |
| InChIKey | IFHMCZLKPVRCEK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)N)N=C(C=C2)Cl |
Computed by PubChem (NCBI)