Products 7462-84-2

CAS 7462-84-2 is the registry number for 1-Methylpiperidine-4-carbonyl chloride hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

1-methylpiperidine-4-carbonyl chloride;hydrochloride (CAS 7462-84-2) is a chemical compound with the molecular formula C7H13Cl2NO and a molecular weight of 198.09 g/mol. IUPAC name: 1-methylpiperidine-4-carbonyl chloride;hydrochloride. InChIKey: NHTZOVLQKKXFJM-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13Cl2NO
Molecular weight198.09 g/mol
IUPAC name1-methylpiperidine-4-carbonyl chloride;hydrochloride
InChIKeyNHTZOVLQKKXFJM-UHFFFAOYSA-N
SMILESCN1CCC(CC1)C(=O)Cl.Cl

Computed by PubChem (NCBI)