Products 74628-20-9
CAS 74628-20-9 appears in our catalog under these names: 3-(4-Methylpiperazin-1-yl)-2-nitroaniline, 95%, 3–(4–Methylpiperazin–1–yl)–2–nitroaniline. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
3-(4-methylpiperazin-1-yl)-2-nitroaniline (CAS 74628-20-9) is a chemical compound with the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. IUPAC name: 3-(4-methylpiperazin-1-yl)-2-nitroaniline. InChIKey: XXUUIQMQPSMPJG-UHFFFAOYSA-N.
| Molecular formula | C11H16N4O2 |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | 3-(4-methylpiperazin-1-yl)-2-nitroaniline |
| InChIKey | XXUUIQMQPSMPJG-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC=CC(=C2[N+](=O)[O-])N |
Computed by PubChem (NCBI)