CAS 7464-09-7 is the registry number for Thiazolo[4,5-d]pyrimidine-5,7-diol, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 1g, 250mg.
4H-[1,3]thiazolo[4,5-d]pyrimidine-5,7-dione (CAS 7464-09-7) is a chemical compound with the molecular formula C5H3N3O2S and a molecular weight of 169.16 g/mol. IUPAC name: 4H-[1,3]thiazolo[4,5-d]pyrimidine-5,7-dione. InChIKey: ZKMLPWOPYCJLKO-UHFFFAOYSA-N.
| Molecular formula | C5H3N3O2S |
|---|---|
| Molecular weight | 169.16 g/mol |
| IUPAC name | 4H-[1,3]thiazolo[4,5-d]pyrimidine-5,7-dione |
| InChIKey | ZKMLPWOPYCJLKO-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(S1)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)