CAS 7465-14-7 is the registry number for 8-Bromo-7-butyl-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-7-butyl-1,3-dimethylpurine-2,6-dione (CAS 7465-14-7) is a chemical compound with the molecular formula C11H15BrN4O2 and a molecular weight of 315.17 g/mol. IUPAC name: 8-bromo-7-butyl-1,3-dimethylpurine-2,6-dione. InChIKey: USKPLHRGRMWYLC-UHFFFAOYSA-N.
| Molecular formula | C11H15BrN4O2 |
|---|---|
| Molecular weight | 315.17 g/mol |
| IUPAC name | 8-bromo-7-butyl-1,3-dimethylpurine-2,6-dione |
| InChIKey | USKPLHRGRMWYLC-UHFFFAOYSA-N |
| SMILES | CCCCN1C2=C(N=C1Br)N(C(=O)N(C2=O)C)C |
Computed by PubChem (NCBI)