CAS 74675-84-6 appears in our catalog under these names: 2-Hydroxy-5-Nitro-N-(4-Phenyl-2-Thiazolyl) Benzamide, 2-Hydroxy-5-nitro-N-(4-phenyl-2-thiazolyl)benzamide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 5g.
2-hydroxy-5-nitro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide (CAS 74675-84-6) is a chemical compound with the molecular formula C16H11N3O4S and a molecular weight of 341.3 g/mol. IUPAC name: 2-hydroxy-5-nitro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide. InChIKey: JHQGEDQRUSOCJJ-UHFFFAOYSA-N.
| Molecular formula | C16H11N3O4S |
|---|---|
| Molecular weight | 341.3 g/mol |
| IUPAC name | 2-hydroxy-5-nitro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide |
| InChIKey | JHQGEDQRUSOCJJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC(=N2)NC(=O)C3=C(C=CC(=C3)[N+](=O)[O-])O |
Computed by PubChem (NCBI)