Products 747-45-5
CAS 747-45-5 is the registry number for Quinidine Sulfate (>85%). Offered by: TRC. Available pack sizes: 10g, 1g, 50g.
(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;sulfuric acid (CAS 747-45-5) is a chemical compound with the molecular formula C20H26N2O6S and a molecular weight of 422.5 g/mol. IUPAC name: (S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;sulfuric acid. InChIKey: AKYHKWQPZHDOBW-VJAUXQICSA-N.
| Molecular formula | C20H26N2O6S |
|---|---|
| Molecular weight | 422.5 g/mol |
| IUPAC name | (S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;sulfuric acid |
| InChIKey | AKYHKWQPZHDOBW-VJAUXQICSA-N |
| SMILES | COC1=CC2=C(C=CN=C2C=C1)[C@@H]([C@H]3C[C@@H]4CCN3C[C@@H]4C=C)O.OS(=O)(=O)O |
Computed by PubChem (NCBI)