CAS 7471-62-7 is the registry number for N2,N2,N4,N4,6-Pentamethylpyrimidine-2,4-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-N,2-N,4-N,4-N,6-pentamethylpyrimidine-2,4-diamine (CAS 7471-62-7) is a chemical compound with the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. IUPAC name: 2-N,2-N,4-N,4-N,6-pentamethylpyrimidine-2,4-diamine. InChIKey: CLUPKZJSRWUNHD-UHFFFAOYSA-N.
| Molecular formula | C9H16N4 |
|---|---|
| Molecular weight | 180.25 g/mol |
| IUPAC name | 2-N,2-N,4-N,4-N,6-pentamethylpyrimidine-2,4-diamine |
| InChIKey | CLUPKZJSRWUNHD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)N(C)C)N(C)C |
Computed by PubChem (NCBI)