CAS 74723-10-7 appears in our catalog under these names: 3-Hydroxy Nor-Flunitrazepam, 3-Hydroxy Nor-Flunitrazepam (Nifoxipam) (1.0 mg/mL in Methanol), Nifoxipam. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 100mg, 1x1ml, 1mg, 5mg, 1 mg, 5 mg.
5-(2-fluorophenyl)-3-hydroxy-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one (CAS 74723-10-7) is a chemical compound with the molecular formula C15H10FN3O4 and a molecular weight of 315.26 g/mol. IUPAC name: 5-(2-fluorophenyl)-3-hydroxy-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one. InChIKey: UHFIFTRHLBAWGY-UHFFFAOYSA-N.
| Molecular formula | C15H10FN3O4 |
|---|---|
| Molecular weight | 315.26 g/mol |
| IUPAC name | 5-(2-fluorophenyl)-3-hydroxy-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one |
| InChIKey | UHFIFTRHLBAWGY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(C(=O)NC3=C2C=C(C=C3)[N+](=O)[O-])O)F |
Computed by PubChem (NCBI)