CAS 747411-15-0 appears in our catalog under these names: 2-Chloro-n-(2-oxo-2-[(2,3,4-trifluorophenyl)amino]ethyl)propanamide, 95%, 2-Chloro-N-{((2,3,4-trifluorophenyl)carbamoyl)methyl}propanamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
2-chloro-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide (CAS 747411-15-0) is a chemical compound with the molecular formula C11H10ClF3N2O2 and a molecular weight of 294.66 g/mol. IUPAC name: 2-chloro-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide. InChIKey: UDEKLBHATAMXDF-UHFFFAOYSA-N.
| Molecular formula | C11H10ClF3N2O2 |
|---|---|
| Molecular weight | 294.66 g/mol |
| IUPAC name | 2-chloro-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide |
| InChIKey | UDEKLBHATAMXDF-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NCC(=O)NC1=C(C(=C(C=C1)F)F)F)Cl |
Computed by PubChem (NCBI)