CAS 747413-21-4 appears in our catalog under these names: 4–(4–Methyl–1–piperazinyl)benzeneboronic acid pinacol ester, 4-(4-Methylpiperazin-1-yl)phenylboronic acid pinacol ester, 97%, 1-Methyl-4-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)piperazine, 97%, 97%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 5g, 1g, 10g, 25g, 100g, 500g, 250mg.
1-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine (CAS 747413-21-4) is a chemical compound with the molecular formula C17H27BN2O2 and a molecular weight of 302.2 g/mol. IUPAC name: 1-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine. InChIKey: RDFJBDMCBVSCFI-UHFFFAOYSA-N.
| Molecular formula | C17H27BN2O2 |
|---|---|
| Molecular weight | 302.2 g/mol |
| IUPAC name | 1-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine |
| InChIKey | RDFJBDMCBVSCFI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)N3CCN(CC3)C |
Computed by PubChem (NCBI)