Products 74764-64-0

CAS 74764-64-0 is the registry number for 4-Amino-2-hydroxy-3,5-diiodobenzoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

4-amino-2-hydroxy-3,5-diiodobenzoic acid (CAS 74764-64-0) is a chemical compound with the molecular formula C7H5I2NO3 and a molecular weight of 404.93 g/mol. IUPAC name: 4-amino-2-hydroxy-3,5-diiodobenzoic acid. InChIKey: FSJFOJCPPGAWML-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5I2NO3
Molecular weight404.93 g/mol
IUPAC name4-amino-2-hydroxy-3,5-diiodobenzoic acid
InChIKeyFSJFOJCPPGAWML-UHFFFAOYSA-N
SMILESC1=C(C(=C(C(=C1I)N)I)O)C(=O)O

Computed by PubChem (NCBI)