CAS 7478-26-4 appears in our catalog under these names: 6-Chloro-2-methoxy-9-phenoxyacridine, 95%, 6-Chloro-2-methoxy-9-phenoxyacridine. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 10g, 2g.
6-chloro-2-methoxy-9-phenoxyacridine (CAS 7478-26-4) is a chemical compound with the molecular formula C20H14ClNO2 and a molecular weight of 335.8 g/mol. IUPAC name: 6-chloro-2-methoxy-9-phenoxyacridine. InChIKey: CKWITQOQGJPKOE-UHFFFAOYSA-N.
| Molecular formula | C20H14ClNO2 |
|---|---|
| Molecular weight | 335.8 g/mol |
| IUPAC name | 6-chloro-2-methoxy-9-phenoxyacridine |
| InChIKey | CKWITQOQGJPKOE-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C3=C(C=C(C=C3)Cl)N=C2C=C1)OC4=CC=CC=C4 |
Computed by PubChem (NCBI)