CAS 74815-81-9 appears in our catalog under these names: 2,3-Dibromo-6,7-dicyanonaphthalene, 95%, 2,3–Dibromo–6,7–dicyanonaphthalene, 2,3-Dibromo-6,7-dicyanonaphthalene, >98.0%(HPLC)(N), 6,7-Dibromonaphthalene-2,3-dicarbonitrile 98%, 6,7-Dibromonaphthalene-2,3-dicarbonitrile, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 200mg, 100mg, 5g.
6,7-dibromonaphthalene-2,3-dicarbonitrile (CAS 74815-81-9) is a chemical compound with the molecular formula C12H4Br2N2 and a molecular weight of 335.98 g/mol. IUPAC name: 6,7-dibromonaphthalene-2,3-dicarbonitrile. InChIKey: YHUVAAVMNCSZQN-UHFFFAOYSA-N.
| Molecular formula | C12H4Br2N2 |
|---|---|
| Molecular weight | 335.98 g/mol |
| IUPAC name | 6,7-dibromonaphthalene-2,3-dicarbonitrile |
| InChIKey | YHUVAAVMNCSZQN-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(C(=CC2=CC(=C1C#N)C#N)Br)Br |
Computed by PubChem (NCBI)