CAS 74833-81-1 appears in our catalog under these names: Bis(1-pyrenylmethyl) Ether, (1,1'-Dipyrenyl)dimethyl ether, 98%, (1,1'–Dipyrenyl)dimethyl ether, (1,1'-Dipyrenyl)dimethyl ether, 98.0%, (1,1'-Dipyrenyl)dimethyl ether, ≥98%, ≥98%. Offered by: TRC, AmBeed, GLPBio, MedChemExpress, Chemat. Available pack sizes: 100mg, 250mg, 50mg, 5mg, 1mg, 5 mg, 1 mg, 25mg.
1-(pyren-1-ylmethoxymethyl)pyrene (CAS 74833-81-1) is a chemical compound with the molecular formula C34H22O and a molecular weight of 446.5 g/mol. IUPAC name: 1-(pyren-1-ylmethoxymethyl)pyrene. InChIKey: KDWSQWLDGXGQTK-UHFFFAOYSA-N.
| Molecular formula | C34H22O |
|---|---|
| Molecular weight | 446.5 g/mol |
| IUPAC name | 1-(pyren-1-ylmethoxymethyl)pyrene |
| InChIKey | KDWSQWLDGXGQTK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)COCC5=C6C=CC7=CC=CC8=C7C6=C(C=C8)C=C5 |
Computed by PubChem (NCBI)