CAS 748735-20-8 appears in our catalog under these names: (R)-2-amino-2-phenylethyl methanesulfonate, Elagolix Impurity 51. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(2R)-2-amino-2-phenylethyl] methanesulfonate (CAS 748735-20-8) is a chemical compound with the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. IUPAC name: [(2R)-2-amino-2-phenylethyl] methanesulfonate. InChIKey: JVLOPNXWWWVODS-VIFPVBQESA-N.
| Molecular formula | C9H13NO3S |
|---|---|
| Molecular weight | 215.27 g/mol |
| IUPAC name | [(2R)-2-amino-2-phenylethyl] methanesulfonate |
| InChIKey | JVLOPNXWWWVODS-VIFPVBQESA-N |
| SMILES | CS(=O)(=O)OC[C@@H](C1=CC=CC=C1)N |
Computed by PubChem (NCBI)