CAS 748776-41-2 appears in our catalog under these names: 2-[((4-[(Difluoromethyl)sulfanyl]phenyl)carbamoyl)methoxy]benzoic acid, 95%, 2-(({4-((difluoromethyl)sulfanyl)phenyl}carbamoyl)methoxy)benzoic acid, 95%, 2-(({4-((Difluoromethyl)sulfanyl)phenyl}carbamoyl)methoxy)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethoxy]benzoic acid (CAS 748776-41-2) is a chemical compound with the molecular formula C16H13F2NO4S and a molecular weight of 353.3 g/mol. IUPAC name: 2-[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethoxy]benzoic acid. InChIKey: RUSYUUPLCCGCGN-UHFFFAOYSA-N.
| Molecular formula | C16H13F2NO4S |
|---|---|
| Molecular weight | 353.3 g/mol |
| IUPAC name | 2-[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethoxy]benzoic acid |
| InChIKey | RUSYUUPLCCGCGN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)OCC(=O)NC2=CC=C(C=C2)SC(F)F |
Computed by PubChem (NCBI)