CAS 748795-21-3 appears in our catalog under these names: (1R)-7-Fluoro-1,2,3,4-tetrahydronaphthalen-1-ol, 95%, (1R)-7-Fluoro-1,2,3,4-tetrahydronaphthalen-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(1R)-7-fluoro-1,2,3,4-tetrahydronaphthalen-1-ol (CAS 748795-21-3) is a chemical compound with the molecular formula C10H11FO and a molecular weight of 166.19 g/mol. IUPAC name: (1R)-7-fluoro-1,2,3,4-tetrahydronaphthalen-1-ol. InChIKey: QNORPDDVMCJPRL-SNVBAGLBSA-N.
| Molecular formula | C10H11FO |
|---|---|
| Molecular weight | 166.19 g/mol |
| IUPAC name | (1R)-7-fluoro-1,2,3,4-tetrahydronaphthalen-1-ol |
| InChIKey | QNORPDDVMCJPRL-SNVBAGLBSA-N |
| SMILES | C1C[C@H](C2=C(C1)C=CC(=C2)F)O |
Computed by PubChem (NCBI)