Products 74892-45-8
CAS 74892-45-8 is the registry number for 5-Acetoxymatairesinol dimethyl ether. Offered by: Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, Get quote.
[(R)-(3,4-dimethoxyphenyl)-[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-5-oxooxolan-3-yl]methyl] acetate (CAS 74892-45-8) is a chemical compound with the molecular formula C24H28O8 and a molecular weight of 444.5 g/mol. IUPAC name: [(R)-(3,4-dimethoxyphenyl)-[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-5-oxooxolan-3-yl]methyl] acetate. InChIKey: CJBJCEARMFPRTA-STSQHVNTSA-N.
| Molecular formula | C24H28O8 |
|---|---|
| Molecular weight | 444.5 g/mol |
| IUPAC name | [(R)-(3,4-dimethoxyphenyl)-[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-5-oxooxolan-3-yl]methyl] acetate |
| InChIKey | CJBJCEARMFPRTA-STSQHVNTSA-N |
| SMILES | CC(=O)O[C@H]([C@H]1COC(=O)[C@@H]1CC2=CC(=C(C=C2)OC)OC)C3=CC(=C(C=C3)OC)OC |
Computed by PubChem (NCBI)