CAS 74900-38-2 is the registry number for 2-amino-1-(1-aza-2-(2-nitrophenyl)vinyl)ethene-1,2-dicarbonitrile. Offered by: Biosynth. Available pack sizes: 250mg.
2-amino-3-[(2-nitrophenyl)methylideneamino]but-2-enedinitrile (CAS 74900-38-2) is a chemical compound with the molecular formula C11H7N5O2 and a molecular weight of 241.21 g/mol. IUPAC name: 2-amino-3-[(2-nitrophenyl)methylideneamino]but-2-enedinitrile. InChIKey: GWSCSOMMIYMXOK-UHFFFAOYSA-N.
| Molecular formula | C11H7N5O2 |
|---|---|
| Molecular weight | 241.21 g/mol |
| IUPAC name | 2-amino-3-[(2-nitrophenyl)methylideneamino]but-2-enedinitrile |
| InChIKey | GWSCSOMMIYMXOK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=NC(=C(C#N)N)C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)