Products 74903-75-6
CAS 74903-75-6 appears in our catalog under these names: 1,4-Di(bromomethyl)benzene-d4, 1,4-Bis(bromomethyl)benzene-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg, 50 mg.
1,4-bis(bromomethyl)-2,3,5,6-tetradeuteriobenzene (CAS 74903-75-6) is a chemical compound with the molecular formula C8H8Br2 and a molecular weight of 267.98 g/mol. IUPAC name: 1,4-bis(bromomethyl)-2,3,5,6-tetradeuteriobenzene. InChIKey: RBZMSGOBSOCYHR-RHQRLBAQSA-N.
| Molecular formula | C8H8Br2 |
|---|---|
| Molecular weight | 267.98 g/mol |
| IUPAC name | 1,4-bis(bromomethyl)-2,3,5,6-tetradeuteriobenzene |
| InChIKey | RBZMSGOBSOCYHR-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1CBr)[2H])[2H])CBr)[2H] |
Computed by PubChem (NCBI)