CAS 749168-24-9 appears in our catalog under these names: Mannose Impurity 14, L-Daunosamine. Offered by: Hubei YoungXin, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
(2R,4S,5S,6S)-4-amino-6-methyloxane-2,5-diol (CAS 749168-24-9) is a chemical compound with the molecular formula C6H13NO3 and a molecular weight of 147.17 g/mol. IUPAC name: (2R,4S,5S,6S)-4-amino-6-methyloxane-2,5-diol. InChIKey: BBMKQGIZNKEDOX-UNTFVMJOSA-N.
| Molecular formula | C6H13NO3 |
|---|---|
| Molecular weight | 147.17 g/mol |
| IUPAC name | (2R,4S,5S,6S)-4-amino-6-methyloxane-2,5-diol |
| InChIKey | BBMKQGIZNKEDOX-UNTFVMJOSA-N |
| SMILES | C[C@H]1[C@H]([C@H](C[C@@H](O1)O)N)O |
Computed by PubChem (NCBI)