Products 74918-57-3

CAS 74918-57-3 is the registry number for 2-Hexyldecanoyl chloride 95%. Offered by: Ambeed. Available pack sizes: 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

2-hexyldecanoyl chloride (CAS 74918-57-3) is a chemical compound with the molecular formula C16H31ClO and a molecular weight of 274.9 g/mol. IUPAC name: 2-hexyldecanoyl chloride. InChIKey: MHEDPJJXDOOCQO-UHFFFAOYSA-N.

Identity
Molecular formulaC16H31ClO
Molecular weight274.9 g/mol
IUPAC name2-hexyldecanoyl chloride
InChIKeyMHEDPJJXDOOCQO-UHFFFAOYSA-N
SMILESCCCCCCCCC(CCCCCC)C(=O)Cl

Computed by PubChem (NCBI)