CAS 749198-26-3 is the registry number for 4-Demethylflucarbazone. Offered by: Chemat Brand. Available pack sizes: on request.
3-methoxy-5-oxo-N-[2-(trifluoromethoxy)phenyl]sulfonyl-4H-1,2,4-triazole-1-carboxamide (CAS 749198-26-3) is a chemical compound with the molecular formula C11H9F3N4O6S and a molecular weight of 382.27 g/mol. IUPAC name: 3-methoxy-5-oxo-N-[2-(trifluoromethoxy)phenyl]sulfonyl-4H-1,2,4-triazole-1-carboxamide. InChIKey: ZPLXAFLIKQVXEL-UHFFFAOYSA-N.
| Molecular formula | C11H9F3N4O6S |
|---|---|
| Molecular weight | 382.27 g/mol |
| IUPAC name | 3-methoxy-5-oxo-N-[2-(trifluoromethoxy)phenyl]sulfonyl-4H-1,2,4-triazole-1-carboxamide |
| InChIKey | ZPLXAFLIKQVXEL-UHFFFAOYSA-N |
| SMILES | COC1=NN(C(=O)N1)C(=O)NS(=O)(=O)C2=CC=CC=C2OC(F)(F)F |
Computed by PubChem (NCBI)