CAS 7492-31-1 appears in our catalog under these names: Isometheptene Mucate, Isometheptane Mucate, >95% (HPLC), Isometheptene mucate, Isometheptane mucate. Offered by: Chemat Brand, TRC, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 25mg, 10mg, 5mg, 50mg.
Bis(N,6-dimethylhept-5-en-2-amine);(2S,3R,4S,5R)-2,3,4,5-tetrahydroxyhexanedioic acid (CAS 7492-31-1) is a chemical compound with the molecular formula C24H48N2O8 and a molecular weight of 492.6 g/mol. IUPAC name: bis(N,6-dimethylhept-5-en-2-amine);(2S,3R,4S,5R)-2,3,4,5-tetrahydroxyhexanedioic acid. InChIKey: WSXKZIDINJKWPM-IBGZLQDMSA-N.
| Molecular formula | C24H48N2O8 |
|---|---|
| Molecular weight | 492.6 g/mol |
| IUPAC name | bis(N,6-dimethylhept-5-en-2-amine);(2S,3R,4S,5R)-2,3,4,5-tetrahydroxyhexanedioic acid |
| InChIKey | WSXKZIDINJKWPM-IBGZLQDMSA-N |
| SMILES | CC(CCC=C(C)C)NC.CC(CCC=C(C)C)NC.[C@@H]([C@@H]([C@H](C(=O)O)O)O)([C@@H](C(=O)O)O)O |
Computed by PubChem (NCBI)