CAS 749230-50-0 appears in our catalog under these names: 4-Chloro-2,3-difluoro-5-hydroxybenzoic acid, 95%, 4-Chloro-2,3-difluoro-5-hydroxybenzoic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
4-chloro-2,3-difluoro-5-hydroxybenzoic acid (CAS 749230-50-0) is a chemical compound with the molecular formula C7H3ClF2O3 and a molecular weight of 208.54 g/mol. IUPAC name: 4-chloro-2,3-difluoro-5-hydroxybenzoic acid. InChIKey: GZVMSWWFTNQKGC-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF2O3 |
|---|---|
| Molecular weight | 208.54 g/mol |
| IUPAC name | 4-chloro-2,3-difluoro-5-hydroxybenzoic acid |
| InChIKey | GZVMSWWFTNQKGC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1O)Cl)F)F)C(=O)O |
Computed by PubChem (NCBI)